C11H24N4O — CID 104888654
1-amino-3-(2-cyclobutylethyl)-2-(3-methoxypropyl)guanidine (PubChem CID 104888654) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-amino-3-(2-cyclobutylethyl)-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-amino-3-(2-cyclobutylethyl)-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 104888654 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-amino-3-(2-cyclobutylethyl)-2-(3-methoxypropyl)guanidine |
| SMILES | COCCC/N=C(\NN)NCCC1CCC1 |
| InChI | InChI=1S/C11H24N4O/c1-16-9-3-7-13-11(15-12)14-8-6-10-4-2-5-10/h10H,2-9,12H2,1H3,(H2,13,14,15) |
| InChIKey | MQCJSBROLSOZQL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|