C8H19N5O3 — CID 104888085
2-[[N-amino-N'-(3-methoxypropyl)carbamimidoyl]amino]ethyl carbamate (PubChem CID 104888085) has the molecular formula C8H19N5O3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[[N-amino-N'-(3-methoxypropyl)carbamimidoyl]amino]ethyl carbamate.
| Compound Name | 2-[[N-amino-N'-(3-methoxypropyl)carbamimidoyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 104888085 |
| Molecular Formula | C8H19N5O3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-[[N-amino-N'-(3-methoxypropyl)carbamimidoyl]amino]ethyl carbamate |
| SMILES | COCCC/N=C(\NN)NCCOC(N)=O |
| InChI | InChI=1S/C8H19N5O3/c1-15-5-2-3-11-8(13-10)12-4-6-16-7(9)14/h2-6,10H2,1H3,(H2,9,14)(H2,11,12,13) |
| InChIKey | NBCGTEZKYGCYHN-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|