C7H17N5O2 — CID 104883842
3-[[N-amino-N'-(2-methoxyethyl)carbamimidoyl]amino]propanamide (PubChem CID 104883842) has the molecular formula C7H17N5O2 and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-[[N-amino-N'-(2-methoxyethyl)carbamimidoyl]amino]propanamide.
| Compound Name | 3-[[N-amino-N'-(2-methoxyethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 104883842 |
| Molecular Formula | C7H17N5O2 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-[[N-amino-N'-(2-methoxyethyl)carbamimidoyl]amino]propanamide |
| SMILES | COCC/N=C(\NN)NCCC(N)=O |
| InChI | InChI=1S/C7H17N5O2/c1-14-5-4-11-7(12-9)10-3-2-6(8)13/h2-5,9H2,1H3,(H2,8,13)(H2,10,11,12) |
| InChIKey | YQBVHTJDILBWRG-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|