C9H22N4OS — CID 104888522
1-amino-3-(2-methoxyethyl)-2-(4-methylsulfanylbutyl)guanidine (PubChem CID 104888522) has the molecular formula C9H22N4OS and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-amino-3-(2-methoxyethyl)-2-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-amino-3-(2-methoxyethyl)-2-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 104888522 |
| Molecular Formula | C9H22N4OS |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-amino-3-(2-methoxyethyl)-2-(4-methylsulfanylbutyl)guanidine |
| SMILES | COCCN/C(=N\CCCCSC)NN |
| InChI | InChI=1S/C9H22N4OS/c1-14-7-6-12-9(13-10)11-5-3-4-8-15-2/h3-8,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | VJVGYEYILDPECW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|