C7H19N5O3S — CID 106341206
1-amino-2-(2-methoxyethyl)-3-[2-(methylsulfamoyl)ethyl]guanidine (PubChem CID 106341206) has the molecular formula C7H19N5O3S and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-amino-2-(2-methoxyethyl)-3-[2-(methylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-amino-2-(2-methoxyethyl)-3-[2-(methylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 106341206 |
| Molecular Formula | C7H19N5O3S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-amino-2-(2-methoxyethyl)-3-[2-(methylsulfamoyl)ethyl]guanidine |
| SMILES | CNS(=O)(=O)CCN/C(=N/CCOC)NN |
| InChI | InChI=1S/C7H19N5O3S/c1-9-16(13,14)6-4-11-7(12-8)10-3-5-15-2/h9H,3-6,8H2,1-2H3,(H2,10,11,12) |
| InChIKey | SNLCLZFAVNBTKT-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|