C12H24N4 — CID 104884107
N-amino-N'-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide (PubChem CID 104884107) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N-amino-N'-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-amino-N'-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 104884107 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N-amino-N'-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CC/N=C(\NN)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C12H24N4/c1-2-14-12(15-13)16-8-7-10-5-3-4-6-11(10)9-16/h10-11H,2-9,13H2,1H3,(H,14,15) |
| InChIKey | VADUAPCRUMDZIM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|