C9H20N4O3 — CID 104884346
1-amino-2-(1,4-dioxan-2-ylmethyl)-3-(2-methoxyethyl)guanidine (PubChem CID 104884346) has the molecular formula C9H20N4O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-amino-2-(1,4-dioxan-2-ylmethyl)-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-amino-2-(1,4-dioxan-2-ylmethyl)-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 104884346 |
| Molecular Formula | C9H20N4O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-amino-2-(1,4-dioxan-2-ylmethyl)-3-(2-methoxyethyl)guanidine |
| SMILES | COCCN/C(=N\CC1COCCO1)NN |
| InChI | InChI=1S/C9H20N4O3/c1-14-3-2-11-9(13-10)12-6-8-7-15-4-5-16-8/h8H,2-7,10H2,1H3,(H2,11,12,13) |
| InChIKey | QAJZGCYAZAWBGE-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|