C13H18O2 — CID 10488497
2-pentyl-2-prop-2-ynylcyclopentane-1,3-dione (PubChem CID 10488497) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-pentyl-2-prop-2-ynylcyclopentane-1,3-dione.
| Compound Name | 2-pentyl-2-prop-2-ynylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 10488497 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-pentyl-2-prop-2-ynylcyclopentane-1,3-dione |
| SMILES | C#CCC1(CCCCC)C(=O)CCC1=O |
| InChI | InChI=1S/C13H18O2/c1-3-5-6-10-13(9-4-2)11(14)7-8-12(13)15/h2H,3,5-10H2,1H3 |
| InChIKey | FMCBOWCNFNBMBW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|