C13H24N6 — CID 104885302
3-amino-2-cyclohexyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 104885302) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 3-amino-2-cyclohexyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 3-amino-2-cyclohexyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104885302 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-amino-2-cyclohexyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | CN(Cc1cnn(C)c1)/C(=N/C1CCCCC1)NN |
| InChI | InChI=1S/C13H24N6/c1-18(9-11-8-15-19(2)10-11)13(17-14)16-12-6-4-3-5-7-12/h8,10,12H,3-7,9,14H2,1-2H3,(H,16,17) |
| InChIKey | FQCHSIIQGPQRPU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|