C16H28N6O — CID 119156772
3-[(1-acetylpiperidin-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 119156772) has the molecular formula C16H28N6O and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[(1-acetylpiperidin-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 3-[(1-acetylpiperidin-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119156772 |
| Molecular Formula | C16H28N6O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 3-[(1-acetylpiperidin-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(C(C)=O)CC1)N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C16H28N6O/c1-13(23)22-7-5-14(6-8-22)9-18-16(17-2)20(3)11-15-10-19-21(4)12-15/h10,12,14H,5-9,11H2,1-4H3,(H,17,18) |
| InChIKey | PWEGYGBJMXTBJN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|