C16H32IN5O2 — CID 111499666
3-[2-(2-butoxyethoxy)ethyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111499666) has the molecular formula C16H32IN5O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 3-[2-(2-butoxyethoxy)ethyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(2-butoxyethoxy)ethyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111499666 |
| Molecular Formula | C16H32IN5O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[2-(2-butoxyethoxy)ethyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)N(C)Cc1cnn(C)c1.I |
| InChI | InChI=1S/C16H31N5O2.HI/c1-5-6-8-22-10-11-23-9-7-18-16(17-2)20(3)13-15-12-19-21(4)14-15;/h12,14H,5-11,13H2,1-4H3,(H,17,18);1H |
| InChIKey | VBPFBFIRVJGYJI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|