C7H13F3N4 — CID 104885808
1-amino-3-cyclopropyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 104885808) has the molecular formula C7H13F3N4 and a molecular weight of 210.20 g/mol. Its IUPAC name is 1-amino-3-cyclopropyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-amino-3-cyclopropyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 104885808 |
| Molecular Formula | C7H13F3N4 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-amino-3-cyclopropyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | NN/C(=N\CCC(F)(F)F)NC1CC1 |
| InChI | InChI=1S/C7H13F3N4/c8-7(9,10)3-4-12-6(14-11)13-5-1-2-5/h5H,1-4,11H2,(H2,12,13,14) |
| InChIKey | HXOAAGDKSQUZSO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|