C11H22F3N5O — CID 104885932
N-amino-N'-(3-methoxypropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 104885932) has the molecular formula C11H22F3N5O and a molecular weight of 297.33 g/mol. Its IUPAC name is N-amino-N'-(3-methoxypropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
| Compound Name | N-amino-N'-(3-methoxypropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104885932 |
| Molecular Formula | C11H22F3N5O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-amino-N'-(3-methoxypropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | COCCC/N=C(\NN)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H22F3N5O/c1-20-8-2-3-16-10(17-15)19-6-4-18(5-7-19)9-11(12,13)14/h2-9,15H2,1H3,(H,16,17) |
| InChIKey | XGOYTDNCNRGEOP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|