C11H25N5 — CID 104886027
N-amino-4-ethyl-3-methyl-N'-propan-2-ylpiperazine-1-carboximidamide (PubChem CID 104886027) has the molecular formula C11H25N5 and a molecular weight of 227.36 g/mol. Its IUPAC name is N-amino-4-ethyl-3-methyl-N'-propan-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-amino-4-ethyl-3-methyl-N'-propan-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104886027 |
| Molecular Formula | C11H25N5 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | N-amino-4-ethyl-3-methyl-N'-propan-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN1CCN(/C(=N/C(C)C)NN)CC1C |
| InChI | InChI=1S/C11H25N5/c1-5-15-6-7-16(8-10(15)4)11(14-12)13-9(2)3/h9-10H,5-8,12H2,1-4H3,(H,13,14) |
| InChIKey | CPVZGGVAKCLBAZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|