C11H24N4 — CID 104883211
N-amino-3,5-dimethyl-N'-propan-2-ylpiperidine-1-carboximidamide (PubChem CID 104883211) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is N-amino-3,5-dimethyl-N'-propan-2-ylpiperidine-1-carboximidamide.
| Compound Name | N-amino-3,5-dimethyl-N'-propan-2-ylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104883211 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | N-amino-3,5-dimethyl-N'-propan-2-ylpiperidine-1-carboximidamide |
| SMILES | CC1CC(C)CN(/C(=N\C(C)C)NN)C1 |
| InChI | InChI=1S/C11H24N4/c1-8(2)13-11(14-12)15-6-9(3)5-10(4)7-15/h8-10H,5-7,12H2,1-4H3,(H,13,14) |
| InChIKey | IPCLFBIESJTIEC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|