C13H25N3 — CID 111153377
N',3,5-trimethyl-N-(2-methylcyclopropyl)piperidine-1-carboximidamide (PubChem CID 111153377) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N',3,5-trimethyl-N-(2-methylcyclopropyl)piperidine-1-carboximidamide.
| Compound Name | N',3,5-trimethyl-N-(2-methylcyclopropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153377 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N',3,5-trimethyl-N-(2-methylcyclopropyl)piperidine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC1C)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C13H25N3/c1-9-5-10(2)8-16(7-9)13(14-4)15-12-6-11(12)3/h9-12H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | RWAPGUZPGCFZDO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|