C15H30N4 — CID 104886736
1-amino-2-cyclohexyl-3-(3,4-dimethylcyclohexyl)guanidine (PubChem CID 104886736) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-amino-2-cyclohexyl-3-(3,4-dimethylcyclohexyl)guanidine.
| Compound Name | 1-amino-2-cyclohexyl-3-(3,4-dimethylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 104886736 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | 1-amino-2-cyclohexyl-3-(3,4-dimethylcyclohexyl)guanidine |
| SMILES | CC1CCC(N/C(=N/C2CCCCC2)NN)CC1C |
| InChI | InChI=1S/C15H30N4/c1-11-8-9-14(10-12(11)2)18-15(19-16)17-13-6-4-3-5-7-13/h11-14H,3-10,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZVGHTUJFTFGVBG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|