C11H24N4 — CID 104886810
1-amino-2-ethyl-3-(3-ethylcyclohexyl)guanidine (PubChem CID 104886810) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-amino-2-ethyl-3-(3-ethylcyclohexyl)guanidine.
| Compound Name | 1-amino-2-ethyl-3-(3-ethylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 104886810 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1-amino-2-ethyl-3-(3-ethylcyclohexyl)guanidine |
| SMILES | CC/N=C(\NN)NC1CCCC(CC)C1 |
| InChI | InChI=1S/C11H24N4/c1-3-9-6-5-7-10(8-9)14-11(15-12)13-4-2/h9-10H,3-8,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | ILHWJIZOJOZBFG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|