C9H19F3N4O — CID 104887041
3-amino-2-(3-methoxypropyl)-1-methyl-1-(3,3,3-trifluoropropyl)guanidine (PubChem CID 104887041) has the molecular formula C9H19F3N4O and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-amino-2-(3-methoxypropyl)-1-methyl-1-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 3-amino-2-(3-methoxypropyl)-1-methyl-1-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 104887041 |
| Molecular Formula | C9H19F3N4O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-amino-2-(3-methoxypropyl)-1-methyl-1-(3,3,3-trifluoropropyl)guanidine |
| SMILES | COCCC/N=C(/NN)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N4O/c1-16(6-4-9(10,11)12)8(15-13)14-5-3-7-17-2/h3-7,13H2,1-2H3,(H,14,15) |
| InChIKey | SCESPNDOMCYDCQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|