C7H16F2N4O — CID 104887789
1-amino-2-(2,2-difluoroethyl)-3-(3-methoxypropyl)guanidine (PubChem CID 104887789) has the molecular formula C7H16F2N4O and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-amino-2-(2,2-difluoroethyl)-3-(3-methoxypropyl)guanidine.
| Compound Name | 1-amino-2-(2,2-difluoroethyl)-3-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 104887789 |
| Molecular Formula | C7H16F2N4O |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-amino-2-(2,2-difluoroethyl)-3-(3-methoxypropyl)guanidine |
| SMILES | COCCCN/C(=N\CC(F)F)NN |
| InChI | InChI=1S/C7H16F2N4O/c1-14-4-2-3-11-7(13-10)12-5-6(8)9/h6H,2-5,10H2,1H3,(H2,11,12,13) |
| InChIKey | FGUYXUQBWAMPJH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|