C6H15N5 — CID 104887916
1-amino-2-cyclopropyl-3-(dimethylamino)guanidine (PubChem CID 104887916) has the molecular formula C6H15N5 and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-amino-2-cyclopropyl-3-(dimethylamino)guanidine.
| Compound Name | 1-amino-2-cyclopropyl-3-(dimethylamino)guanidine |
|---|---|
| PubChem CID | 104887916 |
| Molecular Formula | C6H15N5 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 1-amino-2-cyclopropyl-3-(dimethylamino)guanidine |
| SMILES | CN(C)N/C(=N/C1CC1)NN |
| InChI | InChI=1S/C6H15N5/c1-11(2)10-6(9-7)8-5-3-4-5/h5H,3-4,7H2,1-2H3,(H2,8,9,10) |
| InChIKey | IDLLLVQORZCINR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|