C12H27N5O — CID 104888281
2-[(N-amino-N'-butylcarbamimidoyl)amino]-N,N-diethylpropanamide (PubChem CID 104888281) has the molecular formula C12H27N5O and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[(N-amino-N'-butylcarbamimidoyl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(N-amino-N'-butylcarbamimidoyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 104888281 |
| Molecular Formula | C12H27N5O |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 2-[(N-amino-N'-butylcarbamimidoyl)amino]-N,N-diethylpropanamide |
| SMILES | CCCC/N=C(\NN)NC(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H27N5O/c1-5-8-9-14-12(16-13)15-10(4)11(18)17(6-2)7-3/h10H,5-9,13H2,1-4H3,(H2,14,15,16) |
| InChIKey | MTZNWNUANNCUIA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|