C10H22N4O — CID 104888422
N-amino-3-ethyl-N'-(2-methoxyethyl)pyrrolidine-1-carboximidamide (PubChem CID 104888422) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is N-amino-3-ethyl-N'-(2-methoxyethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-amino-3-ethyl-N'-(2-methoxyethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104888422 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | N-amino-3-ethyl-N'-(2-methoxyethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCC1CCN(/C(=N/CCOC)NN)C1 |
| InChI | InChI=1S/C10H22N4O/c1-3-9-4-6-14(8-9)10(13-11)12-5-7-15-2/h9H,3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | SVBSEVVCWXTEGO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|