C10H24N4S — CID 104889085
1-amino-2-(2-methylpropyl)-3-(1-methylsulfanylbutan-2-yl)guanidine (PubChem CID 104889085) has the molecular formula C10H24N4S and a molecular weight of 232.40 g/mol. Its IUPAC name is 1-amino-2-(2-methylpropyl)-3-(1-methylsulfanylbutan-2-yl)guanidine.
| Compound Name | 1-amino-2-(2-methylpropyl)-3-(1-methylsulfanylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 104889085 |
| Molecular Formula | C10H24N4S |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-amino-2-(2-methylpropyl)-3-(1-methylsulfanylbutan-2-yl)guanidine |
| SMILES | CCC(CSC)N/C(=N/CC(C)C)NN |
| InChI | InChI=1S/C10H24N4S/c1-5-9(7-15-4)13-10(14-11)12-6-8(2)3/h8-9H,5-7,11H2,1-4H3,(H2,12,13,14) |
| InChIKey | YLRGRWBUXNBNDB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|