C9H22N4S — CID 104888713
1-amino-2-(2-methylpropyl)-3-(2-methylsulfanylpropyl)guanidine (PubChem CID 104888713) has the molecular formula C9H22N4S and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-amino-2-(2-methylpropyl)-3-(2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-amino-2-(2-methylpropyl)-3-(2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 104888713 |
| Molecular Formula | C9H22N4S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 1-amino-2-(2-methylpropyl)-3-(2-methylsulfanylpropyl)guanidine |
| SMILES | CSC(C)CN/C(=N/CC(C)C)NN |
| InChI | InChI=1S/C9H22N4S/c1-7(2)5-11-9(13-10)12-6-8(3)14-4/h7-8H,5-6,10H2,1-4H3,(H2,11,12,13) |
| InChIKey | OWNRVOGOQWHVRK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|