C11H19ClN4S — CID 114140187
1-amino-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylpropyl)guanidine (PubChem CID 114140187) has the molecular formula C11H19ClN4S and a molecular weight of 274.82 g/mol. Its IUPAC name is 1-amino-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-amino-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 114140187 |
| Molecular Formula | C11H19ClN4S |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-amino-3-[2-(5-chlorothiophen-2-yl)ethyl]-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\NN)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H19ClN4S/c1-8(2)7-15-11(16-13)14-6-5-9-3-4-10(12)17-9/h3-4,8H,5-7,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | KEWBVZXJKZCDSX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|