C8H13N3S — CID 104889205
(2S)-1-(4-methylpyrimidin-2-yl)sulfanylpropan-2-amine (PubChem CID 104889205) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is (2S)-1-(4-methylpyrimidin-2-yl)sulfanylpropan-2-amine.
| Compound Name | (2S)-1-(4-methylpyrimidin-2-yl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 104889205 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (2S)-1-(4-methylpyrimidin-2-yl)sulfanylpropan-2-amine |
| SMILES | Cc1ccnc(SC[C@H](C)N)n1 |
| InChI | InChI=1S/C8H13N3S/c1-6(9)5-12-8-10-4-3-7(2)11-8/h3-4,6H,5,9H2,1-2H3/t6-/m0/s1 |
| InChIKey | BTXAEVRLAWGZEW-LURJTMIESA-N |
| XLogP | 1.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |