C8H8BrF3N2S — CID 64757135
2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4-methylpyrimidine (PubChem CID 64757135) has the molecular formula C8H8BrF3N2S and a molecular weight of 301.13 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4-methylpyrimidine.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4-methylpyrimidine |
|---|---|
| PubChem CID | 64757135 |
| Molecular Formula | C8H8BrF3N2S |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-4-methylpyrimidine |
| SMILES | Cc1ccnc(SCC(Br)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8BrF3N2S/c1-5-2-3-13-7(14-5)15-4-6(9)8(10,11)12/h2-3,6H,4H2,1H3 |
| InChIKey | HFVSEXCNPKEKJR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|