C16H31NO — CID 104889628
N-tert-butyl-5-(5,5-dimethyloxolan-2-yl)-4-methylpent-3-en-1-amine (PubChem CID 104889628) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-tert-butyl-5-(5,5-dimethyloxolan-2-yl)-4-methylpent-3-en-1-amine.
| Compound Name | N-tert-butyl-5-(5,5-dimethyloxolan-2-yl)-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 104889628 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-tert-butyl-5-(5,5-dimethyloxolan-2-yl)-4-methylpent-3-en-1-amine |
| SMILES | CC(=CCCNC(C)(C)C)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C16H31NO/c1-13(8-7-11-17-15(2,3)4)12-14-9-10-16(5,6)18-14/h8,14,17H,7,9-12H2,1-6H3 |
| InChIKey | GJDLHFCMJXJGTM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|