C15H27NO — CID 104889629
2-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]piperidine (PubChem CID 104889629) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]piperidine.
| Compound Name | 2-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]piperidine |
|---|---|
| PubChem CID | 104889629 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 2-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]piperidine |
| SMILES | CC(=CC1CCC(C)(C)O1)CC1CCCCN1 |
| InChI | InChI=1S/C15H27NO/c1-12(10-13-6-4-5-9-16-13)11-14-7-8-15(2,3)17-14/h11,13-14,16H,4-10H2,1-3H3 |
| InChIKey | PKVSPHHIAVWWQK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|