C13H16BrNO6 — CID 104890716
2-[4-bromo-2-[(1R)-1-hydroxyethyl]-6-nitrophenoxy]pentanoic acid (PubChem CID 104890716) has the molecular formula C13H16BrNO6 and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-[4-bromo-2-[(1R)-1-hydroxyethyl]-6-nitrophenoxy]pentanoic acid.
| Compound Name | 2-[4-bromo-2-[(1R)-1-hydroxyethyl]-6-nitrophenoxy]pentanoic acid |
|---|---|
| PubChem CID | 104890716 |
| Molecular Formula | C13H16BrNO6 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-[4-bromo-2-[(1R)-1-hydroxyethyl]-6-nitrophenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c([C@@H](C)O)cc(Br)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C13H16BrNO6/c1-3-4-11(13(17)18)21-12-9(7(2)16)5-8(14)6-10(12)15(19)20/h5-7,11,16H,3-4H2,1-2H3,(H,17,18)/t7-,11?/m1/s1 |
| InChIKey | XCXNCDWAOLHKMR-DKSCNQEISA-N |
| XLogP | 3.04 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|