C12H15BrN2O5 — CID 104890616
2-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-N,N-dimethylacetamide (PubChem CID 104890616) has the molecular formula C12H15BrN2O5 and a molecular weight of 347.17 g/mol. Its IUPAC name is 2-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 104890616 |
| Molecular Formula | C12H15BrN2O5 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-N,N-dimethylacetamide |
| SMILES | C[C@H](O)c1cc(Br)cc([N+](=O)[O-])c1OCC(=O)N(C)C |
| InChI | InChI=1S/C12H15BrN2O5/c1-7(16)9-4-8(13)5-10(15(18)19)12(9)20-6-11(17)14(2)3/h4-5,7,16H,6H2,1-3H3/t7-/m0/s1 |
| InChIKey | FPAHWIIUIDFJJH-ZETCQYMHSA-N |
| XLogP | 1.88 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|