C11H11BrF3NO5 — CID 116542084
3-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 116542084) has the molecular formula C11H11BrF3NO5 and a molecular weight of 374.11 g/mol. Its IUPAC name is 3-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 116542084 |
| Molecular Formula | C11H11BrF3NO5 |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)c1cc(Br)cc([N+](=O)[O-])c1OCC(O)C(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO5/c1-5(17)7-2-6(12)3-8(16(19)20)10(7)21-4-9(18)11(13,14)15/h2-3,5,9,17-18H,4H2,1H3 |
| InChIKey | VRHRIODARSQUMV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|