C14H20BrNO5 — CID 114494511
1-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 114494511) has the molecular formula C14H20BrNO5 and a molecular weight of 362.22 g/mol. Its IUPAC name is 1-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 1-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114494511 |
| Molecular Formula | C14H20BrNO5 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-[4-bromo-2-(1-hydroxyethyl)-6-nitrophenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CC(O)c1cc(Br)cc([N+](=O)[O-])c1OCC(C)(O)C(C)C |
| InChI | InChI=1S/C14H20BrNO5/c1-8(2)14(4,18)7-21-13-11(9(3)17)5-10(15)6-12(13)16(19)20/h5-6,8-9,17-18H,7H2,1-4H3 |
| InChIKey | HXEFKRZCSSFACC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|