C11H11BrF3NO5 — CID 106705191
1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol (PubChem CID 106705191) has the molecular formula C11H11BrF3NO5 and a molecular weight of 374.11 g/mol. Its IUPAC name is 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol.
| Compound Name | 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 106705191 |
| Molecular Formula | C11H11BrF3NO5 |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol |
| SMILES | CC(O)c1cc(Br)cc([N+](=O)[O-])c1OCOCC(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO5/c1-6(17)8-2-7(12)3-9(16(18)19)10(8)21-5-20-4-11(13,14)15/h2-3,6,17H,4-5H2,1H3 |
| InChIKey | NBVWPJVNPONHIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|