C11H9BrF3NO5 — CID 106704907
1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanone (PubChem CID 106704907) has the molecular formula C11H9BrF3NO5 and a molecular weight of 372.09 g/mol. Its IUPAC name is 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanone.
| Compound Name | 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 106704907 |
| Molecular Formula | C11H9BrF3NO5 |
| Molecular Weight | 372.09 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 1-[5-bromo-3-nitro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)cc([N+](=O)[O-])c1OCOCC(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO5/c1-6(17)8-2-7(12)3-9(16(18)19)10(8)21-5-20-4-11(13,14)15/h2-3H,4-5H2,1H3 |
| InChIKey | DUJFQSJEAXJEGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.09 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|