C12H10BrN3O5 — CID 116541767
1-[5-bromo-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-3-nitrophenyl]ethanone (PubChem CID 116541767) has the molecular formula C12H10BrN3O5 and a molecular weight of 356.13 g/mol. Its IUPAC name is 1-[5-bromo-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-3-nitrophenyl]ethanone.
| Compound Name | 1-[5-bromo-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 116541767 |
| Molecular Formula | C12H10BrN3O5 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 1-[5-bromo-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)cc([N+](=O)[O-])c1OCc1nc(C)no1 |
| InChI | InChI=1S/C12H10BrN3O5/c1-6(17)9-3-8(13)4-10(16(18)19)12(9)20-5-11-14-7(2)15-21-11/h3-4H,5H2,1-2H3 |
| InChIKey | MQISABJRCUJGJI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|