C13H18BrNO5 — CID 104930681
1-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-2-methylbutan-2-ol (PubChem CID 104930681) has the molecular formula C13H18BrNO5 and a molecular weight of 348.19 g/mol. Its IUPAC name is 1-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-2-methylbutan-2-ol.
| Compound Name | 1-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 104930681 |
| Molecular Formula | C13H18BrNO5 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 1-[4-bromo-2-[(1S)-1-hydroxyethyl]-6-nitrophenoxy]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)COc1c([C@H](C)O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrNO5/c1-4-13(3,17)7-20-12-10(8(2)16)5-9(14)6-11(12)15(18)19/h5-6,8,16-17H,4,7H2,1-3H3/t8-,13?/m0/s1 |
| InChIKey | LHJSBZNQFIBYRU-OADYLZGLSA-N |
| XLogP | 2.95 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|