C13H21NO2 — CID 104891624
1-[2-(hydroxymethyl)azepan-1-yl]hexa-2,4-dien-1-one (PubChem CID 104891624) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)azepan-1-yl]hexa-2,4-dien-1-one.
| Compound Name | 1-[2-(hydroxymethyl)azepan-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 104891624 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[2-(hydroxymethyl)azepan-1-yl]hexa-2,4-dien-1-one |
| SMILES | CC=CC=CC(=O)N1CCCCCC1CO |
| InChI | InChI=1S/C13H21NO2/c1-2-3-5-9-13(16)14-10-7-4-6-8-12(14)11-15/h2-3,5,9,12,15H,4,6-8,10-11H2,1H3 |
| InChIKey | VNDRBRXFRMYIDX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|