C9H13Cl2NO2 — CID 104892422
2-[1-(2,3-dichloroprop-2-enyl)azetidin-3-yl]propanoic acid (PubChem CID 104892422) has the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. Its IUPAC name is 2-[1-(2,3-dichloroprop-2-enyl)azetidin-3-yl]propanoic acid.
| Compound Name | 2-[1-(2,3-dichloroprop-2-enyl)azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 104892422 |
| Molecular Formula | C9H13Cl2NO2 |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-[1-(2,3-dichloroprop-2-enyl)azetidin-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1CN(CC(Cl)=CCl)C1 |
| InChI | InChI=1S/C9H13Cl2NO2/c1-6(9(13)14)7-3-12(4-7)5-8(11)2-10/h2,6-7H,3-5H2,1H3,(H,13,14) |
| InChIKey | HUMPOQAFZKZPDG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |