C9H14ClNO2 — CID 116684092
2-[1-[(E)-3-chloroprop-2-enyl]azetidin-3-yl]propanoic acid (PubChem CID 116684092) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 2-[1-[(E)-3-chloroprop-2-enyl]azetidin-3-yl]propanoic acid.
| Compound Name | 2-[1-[(E)-3-chloroprop-2-enyl]azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 116684092 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-[1-[(E)-3-chloroprop-2-enyl]azetidin-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1CN(C/C=C/Cl)C1 |
| InChI | InChI=1S/C9H14ClNO2/c1-7(9(12)13)8-5-11(6-8)4-2-3-10/h2-3,7-8H,4-6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | QFUQLHFLRIOWIO-NSCUHMNNSA-N |
| XLogP | 1.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |