C17H24BrNO3S — CID 104892466
tert-butyl 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-4-methylpiperidine-1-carboxylate (PubChem CID 104892466) has the molecular formula C17H24BrNO3S and a molecular weight of 402.35 g/mol. Its IUPAC name is tert-butyl 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 104892466 |
| Molecular Formula | C17H24BrNO3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl 2-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)C(CC(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C17H24BrNO3S/c1-11-7-8-19(16(21)22-17(2,3)4)12(9-11)10-13(20)14-5-6-15(18)23-14/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | ATPSCDAIYDDDPO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |