C10H16N4O2 — CID 104893311
(2S,3S)-2-amino-3-methyl-N-(6-oxo-1H-pyridazin-3-yl)pentanamide (PubChem CID 104893311) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(6-oxo-1H-pyridazin-3-yl)pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(6-oxo-1H-pyridazin-3-yl)pentanamide |
|---|---|
| PubChem CID | 104893311 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(6-oxo-1H-pyridazin-3-yl)pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H16N4O2/c1-3-6(2)9(11)10(16)12-7-4-5-8(15)14-13-7/h4-6,9H,3,11H2,1-2H3,(H,14,15)(H,12,13,16)/t6-,9-/m0/s1 |
| InChIKey | KFUUMTQKDRRFOV-RCOVLWMOSA-N |
| XLogP | 0.08 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |