C16H16BrF2N — CID 104893366
N-[(1S)-1-(3-bromophenyl)ethyl]-2,2-difluoro-2-phenylethanamine (PubChem CID 104893366) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is N-[(1S)-1-(3-bromophenyl)ethyl]-2,2-difluoro-2-phenylethanamine.
| Compound Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2,2-difluoro-2-phenylethanamine |
|---|---|
| PubChem CID | 104893366 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2,2-difluoro-2-phenylethanamine |
| SMILES | C[C@H](NCC(F)(F)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrF2N/c1-12(13-6-5-9-15(17)10-13)20-11-16(18,19)14-7-3-2-4-8-14/h2-10,12,20H,11H2,1H3/t12-/m0/s1 |
| InChIKey | IXQDTQZOJNOFIV-LBPRGKRZSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |