C11H19Cl2NO — CID 104893914
1-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]propan-2-ol (PubChem CID 104893914) has the molecular formula C11H19Cl2NO and a molecular weight of 252.18 g/mol. Its IUPAC name is 1-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]propan-2-ol.
| Compound Name | 1-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 104893914 |
| Molecular Formula | C11H19Cl2NO |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCCN1CC(Cl)=CCl |
| InChI | InChI=1S/C11H19Cl2NO/c1-9(15)6-11-4-2-3-5-14(11)8-10(13)7-12/h7,9,11,15H,2-6,8H2,1H3 |
| InChIKey | IJQFHTMVWHWOKN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |