C10H17Cl2NO — CID 79173594
2-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]ethanol (PubChem CID 79173594) has the molecular formula C10H17Cl2NO and a molecular weight of 238.16 g/mol. Its IUPAC name is 2-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 79173594 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]ethanol |
| SMILES | OCCC1CCCCN1CC(Cl)=CCl |
| InChI | InChI=1S/C10H17Cl2NO/c11-7-9(12)8-13-5-2-1-3-10(13)4-6-14/h7,10,14H,1-6,8H2 |
| InChIKey | ICAQWUOVSQXSHD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |