C11H14O5 — CID 10489417
dimethyl 2-prop-1-en-2-yl-2,3-dihydrofuran-4,5-dicarboxylate (PubChem CID 10489417) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is dimethyl 2-prop-1-en-2-yl-2,3-dihydrofuran-4,5-dicarboxylate.
| Compound Name | dimethyl 2-prop-1-en-2-yl-2,3-dihydrofuran-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10489417 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | dimethyl 2-prop-1-en-2-yl-2,3-dihydrofuran-4,5-dicarboxylate |
| SMILES | C=C(C)C1CC(C(=O)OC)=C(C(=O)OC)O1 |
| InChI | InChI=1S/C11H14O5/c1-6(2)8-5-7(10(12)14-3)9(16-8)11(13)15-4/h8H,1,5H2,2-4H3 |
| InChIKey | JVWGNRCBJOGTQX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|