C13H14ClN3O2 — CID 104894908
(4-chlorophenyl)methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 104894908) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | (4-chlorophenyl)methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 104894908 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (4-chlorophenyl)methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | N[C@H](Cc1cnc[nH]1)C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-10-3-1-9(2-4-10)7-19-13(18)12(15)5-11-6-16-8-17-11/h1-4,6,8,12H,5,7,15H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | WTUXGVQDJNAGFI-GFCCVEGCSA-N |
| XLogP | 1.68 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |