C17H17IN2O — CID 104896209
(3S)-N-(3-iodo-4-methylphenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 104896209) has the molecular formula C17H17IN2O and a molecular weight of 392.24 g/mol. Its IUPAC name is (3S)-N-(3-iodo-4-methylphenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(3-iodo-4-methylphenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 104896209 |
| Molecular Formula | C17H17IN2O |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (3S)-N-(3-iodo-4-methylphenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2Cc3ccccc3CN2)cc1I |
| InChI | InChI=1S/C17H17IN2O/c1-11-6-7-14(9-15(11)18)20-17(21)16-8-12-4-2-3-5-13(12)10-19-16/h2-7,9,16,19H,8,10H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | QRYTZVALYIUMBH-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|