C16H15IN2O — CID 43124629
N-(3-iodophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 43124629) has the molecular formula C16H15IN2O and a molecular weight of 378.21 g/mol. Its IUPAC name is N-(3-iodophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-(3-iodophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 43124629 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-(3-iodophenyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H15IN2O/c17-13-6-3-7-14(9-13)19-16(20)15-8-11-4-1-2-5-12(11)10-18-15/h1-7,9,15,18H,8,10H2,(H,19,20) |
| InChIKey | DTBSWALWUBAWCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|